C26H26N8O6 — CID 162034626
ethanol;(E)-2-isocyano-3-methoxy-3-(3-nitrophenyl)prop-2-enenitrile;4-isocyano-3-(3-nitrophenyl)-1-propan-2-ylpyrazol-5-amine (PubChem CID 162034626) has the molecular formula C26H26N8O6 and a molecular weight of 546.54 g/mol. Its IUPAC name is ethanol;(E)-2-isocyano-3-methoxy-3-(3-nitrophenyl)prop-2-enenitrile;4-isocyano-3-(3-nitrophenyl)-1-propan-2-ylpyrazol-5-amine.
| Compound Name | ethanol;(E)-2-isocyano-3-methoxy-3-(3-nitrophenyl)prop-2-enenitrile;4-isocyano-3-(3-nitrophenyl)-1-propan-2-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 162034626 |
| Molecular Formula | C26H26N8O6 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | ethanol;(E)-2-isocyano-3-methoxy-3-(3-nitrophenyl)prop-2-enenitrile;4-isocyano-3-(3-nitrophenyl)-1-propan-2-ylpyrazol-5-amine |
| SMILES | CCO.[C-]#[N+]/C(C#N)=C(/OC)c1cccc([N+](=O)[O-])c1.[C-]#[N+]c1c(-c2cccc([N+](=O)[O-])c2)nn(C(C)C)c1N |
| InChI | InChI=1S/C13H13N5O2.C11H7N3O3.C2H6O/c1-8(2)17-13(14)12(15-3)11(16-17)9-5-4-6-10(7-9)18(19)20;1-13-10(7-12)11(17-2)8-4-3-5-9(6-8)14(15)16;1-2-3/h4-8H,14H2,1-2H3;3-6H,2H3;3H,2H2,1H3/b;11-10+; |
| InChIKey | YWMFKKHSDGUYJQ-FEAQHYTASA-N |
| XLogP | 5.52 |
| TPSA | 192.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|