C28H30Br2N6O2 — CID 158545642
(E)-4-(3-bromophenyl)-2-isocyano-3-methoxybut-2-enenitrile;3-[(3-bromophenyl)methyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine;ethanol (PubChem CID 158545642) has the molecular formula C28H30Br2N6O2 and a molecular weight of 642.40 g/mol. Its IUPAC name is (E)-4-(3-bromophenyl)-2-isocyano-3-methoxybut-2-enenitrile;3-[(3-bromophenyl)methyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine;ethanol.
| Compound Name | (E)-4-(3-bromophenyl)-2-isocyano-3-methoxybut-2-enenitrile;3-[(3-bromophenyl)methyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine;ethanol |
|---|---|
| PubChem CID | 158545642 |
| Molecular Formula | C28H30Br2N6O2 |
| Molecular Weight | 642.40 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | (E)-4-(3-bromophenyl)-2-isocyano-3-methoxybut-2-enenitrile;3-[(3-bromophenyl)methyl]-4-isocyano-1-propan-2-ylpyrazol-5-amine;ethanol |
| SMILES | CCO.[C-]#[N+]/C(C#N)=C(\Cc1cccc(Br)c1)OC.[C-]#[N+]c1c(Cc2cccc(Br)c2)nn(C(C)C)c1N |
| InChI | InChI=1S/C14H15BrN4.C12H9BrN2O.C2H6O/c1-9(2)19-14(16)13(17-3)12(18-19)8-10-5-4-6-11(15)7-10;1-15-11(8-14)12(16-2)7-9-4-3-5-10(13)6-9;1-2-3/h4-7,9H,8,16H2,1-2H3;3-6H,7H2,2H3;3H,2H2,1H3/b;12-11+; |
| InChIKey | HPBPRLSWWCDRTN-ITTKMUPFSA-N |
| XLogP | 7.24 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.40 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|