C12H14BrN3O — CID 113300974
3-[(3-bromophenyl)methyl]-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 113300974) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-[(3-bromophenyl)methyl]-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 113300974 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | COCCn1cnnc1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H14BrN3O/c1-17-6-5-16-9-14-15-12(16)8-10-3-2-4-11(13)7-10/h2-4,7,9H,5-6,8H2,1H3 |
| InChIKey | XFEHPGFCRRJNCW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |