C10H19N3O — CID 115393653
4-(2-methoxyethyl)-3-pentyl-1,2,4-triazole (PubChem CID 115393653) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-(2-methoxyethyl)-3-pentyl-1,2,4-triazole.
| Compound Name | 4-(2-methoxyethyl)-3-pentyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115393653 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 4-(2-methoxyethyl)-3-pentyl-1,2,4-triazole |
| SMILES | CCCCCc1nncn1CCOC |
| InChI | InChI=1S/C10H19N3O/c1-3-4-5-6-10-12-11-9-13(10)7-8-14-2/h9H,3-8H2,1-2H3 |
| InChIKey | RPSWNBGWXYDPEA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|