C7H13N3O — CID 115393588
3-ethyl-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 115393588) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-ethyl-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-ethyl-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115393588 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3-ethyl-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | CCc1nncn1CCOC |
| InChI | InChI=1S/C7H13N3O/c1-3-7-9-8-6-10(7)4-5-11-2/h6H,3-5H2,1-2H3 |
| InChIKey | JYTYEDSKGCZQJK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |