C9H17N3O2 — CID 115393769
3-(2-ethoxyethyl)-4-(2-methoxyethyl)-1,2,4-triazole (PubChem CID 115393769) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-4-(2-methoxyethyl)-1,2,4-triazole.
| Compound Name | 3-(2-ethoxyethyl)-4-(2-methoxyethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115393769 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 3-(2-ethoxyethyl)-4-(2-methoxyethyl)-1,2,4-triazole |
| SMILES | CCOCCc1nncn1CCOC |
| InChI | InChI=1S/C9H17N3O2/c1-3-14-6-4-9-11-10-8-12(9)5-7-13-2/h8H,3-7H2,1-2H3 |
| InChIKey | JSSHXFSNJDTFPV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|