C10H20N4 — CID 165358643
3-octyl-1,2,4-triazol-4-amine (PubChem CID 165358643) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 3-octyl-1,2,4-triazol-4-amine.
| Compound Name | 3-octyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 165358643 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 3-octyl-1,2,4-triazol-4-amine |
| SMILES | CCCCCCCCc1nncn1N |
| InChI | InChI=1S/C10H20N4/c1-2-3-4-5-6-7-8-10-13-12-9-14(10)11/h9H,2-8,11H2,1H3 |
| InChIKey | FKKZEUXSZHQORP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|