C13H27N5 — CID 574678
5-undecyl-1,2,4-triazole-3,4-diamine (PubChem CID 574678) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is 5-undecyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-undecyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 574678 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | 5-undecyl-1,2,4-triazole-3,4-diamine |
| SMILES | CCCCCCCCCCCc1nnc(N)n1N |
| InChI | InChI=1S/C13H27N5/c1-2-3-4-5-6-7-8-9-10-11-12-16-17-13(14)18(12)15/h2-11,15H2,1H3,(H2,14,17) |
| InChIKey | UEEFBBABCBKWDA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|