C14H28N4 — CID 112593090
(5-octyl-4-propan-2-yl-1,2,4-triazol-3-yl)methanamine (PubChem CID 112593090) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is (5-octyl-4-propan-2-yl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (5-octyl-4-propan-2-yl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 112593090 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (5-octyl-4-propan-2-yl-1,2,4-triazol-3-yl)methanamine |
| SMILES | CCCCCCCCc1nnc(CN)n1C(C)C |
| InChI | InChI=1S/C14H28N4/c1-4-5-6-7-8-9-10-13-16-17-14(11-15)18(13)12(2)3/h12H,4-11,15H2,1-3H3 |
| InChIKey | UGUPNJKEUSCDMC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|