C9H18N4 — CID 112593519
(5-butyl-4-ethyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 112593519) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is (5-butyl-4-ethyl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (5-butyl-4-ethyl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 112593519 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (5-butyl-4-ethyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | CCCCc1nnc(CN)n1CC |
| InChI | InChI=1S/C9H18N4/c1-3-5-6-8-11-12-9(7-10)13(8)4-2/h3-7,10H2,1-2H3 |
| InChIKey | YDTOCUKEAIECPY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |