C13H18N4 — CID 112592719
(5-butyl-4-phenyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 112592719) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is (5-butyl-4-phenyl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (5-butyl-4-phenyl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 112592719 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (5-butyl-4-phenyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | CCCCc1nnc(CN)n1-c1ccccc1 |
| InChI | InChI=1S/C13H18N4/c1-2-3-9-12-15-16-13(10-14)17(12)11-7-5-4-6-8-11/h4-8H,2-3,9-10,14H2,1H3 |
| InChIKey | SPOYPCLTGOBBGU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |