C10H20N4 — CID 114754387
(5-hexyl-4-methyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 114754387) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is (5-hexyl-4-methyl-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (5-hexyl-4-methyl-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 114754387 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | (5-hexyl-4-methyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | CCCCCCc1nnc(CN)n1C |
| InChI | InChI=1S/C10H20N4/c1-3-4-5-6-7-9-12-13-10(8-11)14(9)2/h3-8,11H2,1-2H3 |
| InChIKey | QANAMQMLWLUGSR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|