About (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine
(4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine (PubChem CID 112593130) has the molecular formula C15H28N4
and a molecular weight of 264.42 g/mol. Its IUPAC name is (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine |
| PubChem CID | 112593130 |
| Molecular Formula | C15H28N4 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine |
| SMILES | CCCCCCCCCc1nnc(CN)n1C1CC1 |
| InChI | InChI=1S/C15H28N4/c1-2-3-4-5-6-7-8-9-14-17-18-15(12-16)19(14)13-10-11-13/h13H,2-12,16H2,1H3 |
| InChIKey | GOBMJVNNSAMALB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine?
The IUPAC name of (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine (CID 112593130) is (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine.
What is the SMILES notation for (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine?
The canonical SMILES for (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine is CCCCCCCCCc1nnc(CN)n1C1CC1.
What is the InChIKey of (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine?
The InChIKey is GOBMJVNNSAMALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4/c1-2-3-4-5-6-7-8-9-14-17-18-15(12-16)19(14)13-10-11-13/h13H,2-12,16H2,1H3.
What are the key properties of (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine?
(4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine has a molecular weight of 264.42 g/mol, XLogP of 3.36, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-5-nonyl-1,2,4-triazol-3-yl)methanamine is sourced from PubChem (CID 112593130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).