C9H14FN3O2S — CID 165466298
5-butyl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride (PubChem CID 165466298) has the molecular formula C9H14FN3O2S and a molecular weight of 247.29 g/mol. Its IUPAC name is 5-butyl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride.
| Compound Name | 5-butyl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 165466298 |
| Molecular Formula | C9H14FN3O2S |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 5-butyl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride |
| SMILES | CCCCc1nnc(S(=O)(=O)F)n1C1CC1 |
| InChI | InChI=1S/C9H14FN3O2S/c1-2-3-4-8-11-12-9(16(10,14)15)13(8)7-5-6-7/h7H,2-6H2,1H3 |
| InChIKey | BWDLSNBZFAZMOO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |