About 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride
5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride (PubChem CID 165465910) has the molecular formula C9H14FN3O2S
and a molecular weight of 247.29 g/mol. Its IUPAC name is 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride.
Analyze 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride?
The IUPAC name of 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride (CID 165465910) is 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride.
What is the SMILES notation for 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride?
The canonical SMILES for 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride is CCC(C)c1nnc(S(=O)(=O)F)n1C1CC1.
What is the InChIKey of 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride?
The InChIKey is IJFAQZKHBMBPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN3O2S/c1-3-6(2)8-11-12-9(16(10,14)15)13(8)7-4-5-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride?
5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride has a molecular weight of 247.29 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-4-cyclopropyl-1,2,4-triazole-3-sulfonyl fluoride is sourced from PubChem (CID 165465910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).