C8H6ClF6N3O2S — CID 103311339
4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103311339) has the molecular formula C8H6ClF6N3O2S and a molecular weight of 357.66 g/mol. Its IUPAC name is 4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103311339 |
| Molecular Formula | C8H6ClF6N3O2S |
| Molecular Weight | 357.66 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-cyclopropyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nnc(C(C(F)(F)F)C(F)(F)F)n1C1CC1 |
| InChI | InChI=1S/C8H6ClF6N3O2S/c9-21(19,20)6-17-16-5(18(6)3-1-2-3)4(7(10,11)12)8(13,14)15/h3-4H,1-2H2 |
| InChIKey | VZVAYGCDPUYHQO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |