C8H8ClF6N3O2S — CID 103311338
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103311338) has the molecular formula C8H8ClF6N3O2S and a molecular weight of 359.68 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103311338 |
| Molecular Formula | C8H8ClF6N3O2S |
| Molecular Weight | 359.68 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propan-2-yl-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CC(C)n1c(C(C(F)(F)F)C(F)(F)F)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H8ClF6N3O2S/c1-3(2)18-5(16-17-6(18)21(9,19)20)4(7(10,11)12)8(13,14)15/h3-4H,1-2H3 |
| InChIKey | LMVXCJIKTGTWMO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |