C7H6ClF6N3O2S — CID 103311340
4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103311340) has the molecular formula C7H6ClF6N3O2S and a molecular weight of 345.65 g/mol. Its IUPAC name is 4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103311340 |
| Molecular Formula | C7H6ClF6N3O2S |
| Molecular Weight | 345.65 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CCn1c(C(C(F)(F)F)C(F)(F)F)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H6ClF6N3O2S/c1-2-17-4(15-16-5(17)20(8,18)19)3(6(9,10)11)7(12,13)14/h3H,2H2,1H3 |
| InChIKey | NTRSAZBOVCKPPR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |