C6H4ClF6N3O2S — CID 103311342
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103311342) has the molecular formula C6H4ClF6N3O2S and a molecular weight of 331.63 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103311342 |
| Molecular Formula | C6H4ClF6N3O2S |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-methyl-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | Cn1c(C(C(F)(F)F)C(F)(F)F)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C6H4ClF6N3O2S/c1-16-3(14-15-4(16)19(7,17)18)2(5(8,9)10)6(11,12)13/h2H,1H3 |
| InChIKey | RCVSFVXCQIZVPU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |