4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid

C4H4F3N3O3S — CID 10933308

IUPAC4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid
SMILESCn1c(C(F)(F)F)nnc1S(=O)(=O)O
InChIInChI=1S/C4H4F3N3O3S/c1-10-2(4(5,6)7)8-9-3(10)14(11,12)13/h1H3,(H,11,12,13)
InChIKeyHEBZDOYAZNOBGA-UHFFFAOYSA-N
MW231.16 g/mol
LogP0.08
Rot. Bonds1

About 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid

4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid (PubChem CID 10933308) has the molecular formula C4H4F3N3O3S and a molecular weight of 231.16 g/mol. Its IUPAC name is 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid.

Molecular Properties

Compound Name4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid
PubChem CID10933308
Molecular FormulaC4H4F3N3O3S
Molecular Weight231.16 g/mol
Exact Mass230.99
IUPAC Name4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid
SMILESCn1c(C(F)(F)F)nnc1S(=O)(=O)O
InChIInChI=1S/C4H4F3N3O3S/c1-10-2(4(5,6)7)8-9-3(10)14(11,12)13/h1H3,(H,11,12,13)
InChIKeyHEBZDOYAZNOBGA-UHFFFAOYSA-N
XLogP0.08
TPSA85.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.16
LogP ≤ 50.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
The IUPAC name of 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid (CID 10933308) is 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid.
What is the SMILES notation for 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
The canonical SMILES for 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid is Cn1c(C(F)(F)F)nnc1S(=O)(=O)O.
What is the InChIKey of 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
The InChIKey is HEBZDOYAZNOBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F3N3O3S/c1-10-2(4(5,6)7)8-9-3(10)14(11,12)13/h1H3,(H,11,12,13).
What are the key properties of 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid has a molecular weight of 231.16 g/mol, XLogP of 0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid is sourced from PubChem (CID 10933308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).