C4H4F3N3O3S — CID 10933308
4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid (PubChem CID 10933308) has the molecular formula C4H4F3N3O3S and a molecular weight of 231.16 g/mol. Its IUPAC name is 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid.
| Compound Name | 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid |
|---|---|
| PubChem CID | 10933308 |
| Molecular Formula | C4H4F3N3O3S |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid |
| SMILES | Cn1c(C(F)(F)F)nnc1S(=O)(=O)O |
| InChI | InChI=1S/C4H4F3N3O3S/c1-10-2(4(5,6)7)8-9-3(10)14(11,12)13/h1H3,(H,11,12,13) |
| InChIKey | HEBZDOYAZNOBGA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|