C5H6F3N3O3S — CID 21475360
4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid (PubChem CID 21475360) has the molecular formula C5H6F3N3O3S and a molecular weight of 245.18 g/mol. Its IUPAC name is 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid.
| Compound Name | 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid |
|---|---|
| PubChem CID | 21475360 |
| Molecular Formula | C5H6F3N3O3S |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 4-ethyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid |
| SMILES | CCn1c(C(F)(F)F)nnc1S(=O)(=O)O |
| InChI | InChI=1S/C5H6F3N3O3S/c1-2-11-3(5(6,7)8)9-10-4(11)15(12,13)14/h2H2,1H3,(H,12,13,14) |
| InChIKey | NERYYZWTMKKYNW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|