About sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid
sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid (PubChem CID 173328331) has the molecular formula C4H5F3N3NaO3S
and a molecular weight of 255.15 g/mol. Its IUPAC name is sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid.
Molecular Properties
| Compound Name | sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid |
| PubChem CID | 173328331 |
| Molecular Formula | C4H5F3N3NaO3S |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid |
| SMILES | Cn1c(C(F)(F)F)nnc1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H4F3N3O3S.Na.H/c1-10-2(4(5,6)7)8-9-3(10)14(11,12)13;;/h1H3,(H,11,12,13);;/q;+1;-1 |
| InChIKey | ZVRXPVHDUMLVIL-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
The IUPAC name of sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid (CID 173328331) is sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid.
What is the SMILES notation for sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
The canonical SMILES for sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid is Cn1c(C(F)(F)F)nnc1S(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
The InChIKey is ZVRXPVHDUMLVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F3N3O3S.Na.H/c1-10-2(4(5,6)7)8-9-3(10)14(11,12)13;;/h1H3,(H,11,12,13);;/q;+1;-1.
What are the key properties of sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid?
sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid has a molecular weight of 255.15 g/mol, XLogP of -2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-sulfonic acid is sourced from PubChem (CID 173328331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).