C7H10ClF2N3O3S — CID 103213808
5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103213808) has the molecular formula C7H10ClF2N3O3S and a molecular weight of 289.69 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103213808 |
| Molecular Formula | C7H10ClF2N3O3S |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | Cn1c(CCOCC(F)F)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H10ClF2N3O3S/c1-13-6(2-3-16-4-5(9)10)11-12-7(13)17(8,14)15/h5H,2-4H2,1H3 |
| InChIKey | KTEBJWVUFWJQAX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|