C9H12ClF2N3O3S — CID 103213794
4-cyclopropyl-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103213794) has the molecular formula C9H12ClF2N3O3S and a molecular weight of 315.73 g/mol. Its IUPAC name is 4-cyclopropyl-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-cyclopropyl-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103213794 |
| Molecular Formula | C9H12ClF2N3O3S |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4-cyclopropyl-5-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nnc(CCOCC(F)F)n1C1CC1 |
| InChI | InChI=1S/C9H12ClF2N3O3S/c10-19(16,17)9-14-13-8(15(9)6-1-2-6)3-4-18-5-7(11)12/h6-7H,1-5H2 |
| InChIKey | DOPIXKZWNSPFJI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|