C9H13ClF3N3O3S — CID 103213791
4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103213791) has the molecular formula C9H13ClF3N3O3S and a molecular weight of 335.74 g/mol. Its IUPAC name is 4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103213791 |
| Molecular Formula | C9H13ClF3N3O3S |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 4-propan-2-yl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CC(C)n1c(CCOCC(F)(F)F)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H13ClF3N3O3S/c1-6(2)16-7(3-4-19-5-9(11,12)13)14-15-8(16)20(10,17)18/h6H,3-5H2,1-2H3 |
| InChIKey | WFVXQFKUUQYPRZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|