C8H12ClF2N3O3S — CID 103213802
5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 103213802) has the molecular formula C8H12ClF2N3O3S and a molecular weight of 303.72 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 103213802 |
| Molecular Formula | C8H12ClF2N3O3S |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CCn1c(CCOCC(F)F)nnc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H12ClF2N3O3S/c1-2-14-7(3-4-17-5-6(10)11)12-13-8(14)18(9,15)16/h6H,2-5H2,1H3 |
| InChIKey | DKUYMRRJGSYUBM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|