C8H10F6N4O2S — CID 103311346
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propyl-1,2,4-triazole-3-sulfonamide (PubChem CID 103311346) has the molecular formula C8H10F6N4O2S and a molecular weight of 340.25 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propyl-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propyl-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103311346 |
| Molecular Formula | C8H10F6N4O2S |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-propyl-1,2,4-triazole-3-sulfonamide |
| SMILES | CCCn1c(C(C(F)(F)F)C(F)(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C8H10F6N4O2S/c1-2-3-18-5(16-17-6(18)21(15,19)20)4(7(9,10)11)8(12,13)14/h4H,2-3H2,1H3,(H2,15,19,20) |
| InChIKey | GWICQGDXZMJAQM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |