C7H12F2N4O3S — CID 103213839
5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonamide (PubChem CID 103213839) has the molecular formula C7H12F2N4O3S and a molecular weight of 270.26 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213839 |
| Molecular Formula | C7H12F2N4O3S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-methyl-1,2,4-triazole-3-sulfonamide |
| SMILES | Cn1c(CCOCC(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C7H12F2N4O3S/c1-13-6(2-3-16-4-5(8)9)11-12-7(13)17(10,14)15/h5H,2-4H2,1H3,(H2,10,14,15) |
| InChIKey | OKLMZQAUPLJGPV-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|