C10H17F3N4O3S — CID 103213845
4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide (PubChem CID 103213845) has the molecular formula C10H17F3N4O3S and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213845 |
| Molecular Formula | C10H17F3N4O3S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-(2-methylpropyl)-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)Cn1c(CCOCC(F)(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C10H17F3N4O3S/c1-7(2)5-17-8(3-4-20-6-10(11,12)13)15-16-9(17)21(14,18)19/h7H,3-6H2,1-2H3,(H2,14,18,19) |
| InChIKey | TVYAUFNYBFEARB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|