C8H14F2N4O3S — CID 103213828
5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonamide (PubChem CID 103213828) has the molecular formula C8H14F2N4O3S and a molecular weight of 284.29 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213828 |
| Molecular Formula | C8H14F2N4O3S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-ethyl-1,2,4-triazole-3-sulfonamide |
| SMILES | CCn1c(CCOCC(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C8H14F2N4O3S/c1-2-14-7(3-4-17-5-6(9)10)12-13-8(14)18(11,15)16/h6H,2-5H2,1H3,(H2,11,15,16) |
| InChIKey | LYSFWRSELIDBEY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|