C8H13F3N4O3S — CID 103213830
4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide (PubChem CID 103213830) has the molecular formula C8H13F3N4O3S and a molecular weight of 302.28 g/mol. Its IUPAC name is 4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213830 |
| Molecular Formula | C8H13F3N4O3S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
| SMILES | CCn1c(CCOCC(F)(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C8H13F3N4O3S/c1-2-15-6(3-4-18-5-8(9,10)11)13-14-7(15)19(12,16)17/h2-5H2,1H3,(H2,12,16,17) |
| InChIKey | NPOYRKMQFNSCKH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|