C9H16F2N4O3S — CID 103213818
5-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole-3-sulfonamide (PubChem CID 103213818) has the molecular formula C9H16F2N4O3S and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213818 |
| Molecular Formula | C9H16F2N4O3S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-propan-2-yl-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)n1c(CCOCC(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C9H16F2N4O3S/c1-6(2)15-8(3-4-18-5-7(10)11)13-14-9(15)19(12,16)17/h6-7H,3-5H2,1-2H3,(H2,12,16,17) |
| InChIKey | DOOREKDLUHGVQG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|