C10H18F2N4O3S — CID 103213843
5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide (PubChem CID 103213843) has the molecular formula C10H18F2N4O3S and a molecular weight of 312.34 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213843 |
| Molecular Formula | C10H18F2N4O3S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)ethyl]-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)Cn1c(CCOCC(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C10H18F2N4O3S/c1-7(2)5-16-9(3-4-19-6-8(11)12)14-15-10(16)20(13,17)18/h7-8H,3-6H2,1-2H3,(H2,13,17,18) |
| InChIKey | NZROUZPURYZTCC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|