C7H11F3N4O3S — CID 103213841
4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide (PubChem CID 103213841) has the molecular formula C7H11F3N4O3S and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213841 |
| Molecular Formula | C7H11F3N4O3S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-methyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
| SMILES | Cn1c(CCOCC(F)(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C7H11F3N4O3S/c1-14-5(2-3-17-4-7(8,9)10)12-13-6(14)18(11,15)16/h2-4H2,1H3,(H2,11,15,16) |
| InChIKey | ILYANHABUKJLQG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|