C9H15F3N4O3S — CID 103213833
4-propyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide (PubChem CID 103213833) has the molecular formula C9H15F3N4O3S and a molecular weight of 316.31 g/mol. Its IUPAC name is 4-propyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-propyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103213833 |
| Molecular Formula | C9H15F3N4O3S |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-propyl-5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,2,4-triazole-3-sulfonamide |
| SMILES | CCCn1c(CCOCC(F)(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C9H15F3N4O3S/c1-2-4-16-7(3-5-19-6-9(10,11)12)14-15-8(16)20(13,17)18/h2-6H2,1H3,(H2,13,17,18) |
| InChIKey | BBOBQENORODMJZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|