C7H8F6N4O2S — CID 103311345
4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide (PubChem CID 103311345) has the molecular formula C7H8F6N4O2S and a molecular weight of 326.22 g/mol. Its IUPAC name is 4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 103311345 |
| Molecular Formula | C7H8F6N4O2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 4-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-1,2,4-triazole-3-sulfonamide |
| SMILES | CCn1c(C(C(F)(F)F)C(F)(F)F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C7H8F6N4O2S/c1-2-17-4(15-16-5(17)20(14,18)19)3(6(8,9)10)7(11,12)13/h3H,2H2,1H3,(H2,14,18,19) |
| InChIKey | FNKVGDINQHOVKL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |