C14H26ClN3 — CID 113302063
3-(chloromethyl)-4-ethyl-5-nonyl-1,2,4-triazole (PubChem CID 113302063) has the molecular formula C14H26ClN3 and a molecular weight of 271.84 g/mol. Its IUPAC name is 3-(chloromethyl)-4-ethyl-5-nonyl-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-4-ethyl-5-nonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 113302063 |
| Molecular Formula | C14H26ClN3 |
| Molecular Weight | 271.84 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-(chloromethyl)-4-ethyl-5-nonyl-1,2,4-triazole |
| SMILES | CCCCCCCCCc1nnc(CCl)n1CC |
| InChI | InChI=1S/C14H26ClN3/c1-3-5-6-7-8-9-10-11-13-16-17-14(12-15)18(13)4-2/h3-12H2,1-2H3 |
| InChIKey | MLVUVBNYMVVFKT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|