C11H20BrN3 — CID 114754363
3-(bromomethyl)-4-ethyl-5-hexyl-1,2,4-triazole (PubChem CID 114754363) has the molecular formula C11H20BrN3 and a molecular weight of 274.21 g/mol. Its IUPAC name is 3-(bromomethyl)-4-ethyl-5-hexyl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-4-ethyl-5-hexyl-1,2,4-triazole |
|---|---|
| PubChem CID | 114754363 |
| Molecular Formula | C11H20BrN3 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(bromomethyl)-4-ethyl-5-hexyl-1,2,4-triazole |
| SMILES | CCCCCCc1nnc(CBr)n1CC |
| InChI | InChI=1S/C11H20BrN3/c1-3-5-6-7-8-10-13-14-11(9-12)15(10)4-2/h3-9H2,1-2H3 |
| InChIKey | CWKNBVZHIJLCMG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|