C12H24N4O2S — CID 113366295
5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide (PubChem CID 113366295) has the molecular formula C12H24N4O2S and a molecular weight of 288.42 g/mol. Its IUPAC name is 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 113366295 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide |
| SMILES | CCCCCCCc1nnc(S(N)(=O)=O)n1C(C)C |
| InChI | InChI=1S/C12H24N4O2S/c1-4-5-6-7-8-9-11-14-15-12(19(13,17)18)16(11)10(2)3/h10H,4-9H2,1-3H3,(H2,13,17,18) |
| InChIKey | OTARVHGYRVCWQW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|