About 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide
5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide (PubChem CID 113366295) has the molecular formula C12H24N4O2S
and a molecular weight of 288.42 g/mol. Its IUPAC name is 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide.
Molecular Properties
| Compound Name | 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide |
| PubChem CID | 113366295 |
| Molecular Formula | C12H24N4O2S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide |
| SMILES | CCCCCCCc1nnc(S(N)(=O)=O)n1C(C)C |
| InChI | InChI=1S/C12H24N4O2S/c1-4-5-6-7-8-9-11-14-15-12(19(13,17)18)16(11)10(2)3/h10H,4-9H2,1-3H3,(H2,13,17,18) |
| InChIKey | OTARVHGYRVCWQW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide?
The IUPAC name of 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide (CID 113366295) is 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide.
What is the SMILES notation for 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide?
The canonical SMILES for 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide is CCCCCCCc1nnc(S(N)(=O)=O)n1C(C)C.
What is the InChIKey of 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide?
The InChIKey is OTARVHGYRVCWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2S/c1-4-5-6-7-8-9-11-14-15-12(19(13,17)18)16(11)10(2)3/h10H,4-9H2,1-3H3,(H2,13,17,18).
What are the key properties of 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide?
5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide has a molecular weight of 288.42 g/mol, XLogP of 2.02, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-heptyl-4-propan-2-yl-1,2,4-triazole-3-sulfonamide is sourced from PubChem (CID 113366295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).