C12H18N4O2S2 — CID 113366302
4-propan-2-yl-5-(3-thiophen-2-ylpropyl)-1,2,4-triazole-3-sulfonamide (PubChem CID 113366302) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 4-propan-2-yl-5-(3-thiophen-2-ylpropyl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-propan-2-yl-5-(3-thiophen-2-ylpropyl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 113366302 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 4-propan-2-yl-5-(3-thiophen-2-ylpropyl)-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)n1c(CCCc2cccs2)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C12H18N4O2S2/c1-9(2)16-11(14-15-12(16)20(13,17)18)7-3-5-10-6-4-8-19-10/h4,6,8-9H,3,5,7H2,1-2H3,(H2,13,17,18) |
| InChIKey | XOPUSAYLLUHCGO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |