C11H15N5O2S — CID 113366305
4-propan-2-yl-5-(pyridin-4-ylmethyl)-1,2,4-triazole-3-sulfonamide (PubChem CID 113366305) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 4-propan-2-yl-5-(pyridin-4-ylmethyl)-1,2,4-triazole-3-sulfonamide.
| Compound Name | 4-propan-2-yl-5-(pyridin-4-ylmethyl)-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 113366305 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 4-propan-2-yl-5-(pyridin-4-ylmethyl)-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)n1c(Cc2ccncc2)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C11H15N5O2S/c1-8(2)16-10(7-9-3-5-13-6-4-9)14-15-11(16)19(12,17)18/h3-6,8H,7H2,1-2H3,(H2,12,17,18) |
| InChIKey | GXLZGCZELYZYLP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |