C11H17N5 — CID 141276323
3-hexyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 141276323) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 3-hexyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-hexyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 141276323 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-hexyl-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCCCCCc1nnc2ccc(N)nn12 |
| InChI | InChI=1S/C11H17N5/c1-2-3-4-5-6-10-13-14-11-8-7-9(12)15-16(10)11/h7-8H,2-6H2,1H3,(H2,12,15) |
| InChIKey | QNRSSTZYMUIQPN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|