C12H17ClN4 — CID 43144368
6-chloro-3-heptyl-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 43144368) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is 6-chloro-3-heptyl-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-chloro-3-heptyl-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 43144368 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 6-chloro-3-heptyl-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCCCCCCc1nnc2ccc(Cl)nn12 |
| InChI | InChI=1S/C12H17ClN4/c1-2-3-4-5-6-7-11-14-15-12-9-8-10(13)16-17(11)12/h8-9H,2-7H2,1H3 |
| InChIKey | VUNTWVOBGIKOSU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|