C7H16N6 — CID 107146750
5-[(1S)-1-aminopentyl]-1,2,4-triazole-3,4-diamine (PubChem CID 107146750) has the molecular formula C7H16N6 and a molecular weight of 184.25 g/mol. Its IUPAC name is 5-[(1S)-1-aminopentyl]-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-[(1S)-1-aminopentyl]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 107146750 |
| Molecular Formula | C7H16N6 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | 5-[(1S)-1-aminopentyl]-1,2,4-triazole-3,4-diamine |
| SMILES | CCCC[C@H](N)c1nnc(N)n1N |
| InChI | InChI=1S/C7H16N6/c1-2-3-4-5(8)6-11-12-7(9)13(6)10/h5H,2-4,8,10H2,1H3,(H2,9,12)/t5-/m0/s1 |
| InChIKey | ACVUJAXKKZUABW-YFKPBYRVSA-N |
| XLogP | -0.24 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |