C13H18N4 — CID 62709915
1-(4-phenyl-1,2,4-triazol-3-yl)pentan-1-amine (PubChem CID 62709915) has the molecular formula C13H18N4 and a molecular weight of 230.32 g/mol. Its IUPAC name is 1-(4-phenyl-1,2,4-triazol-3-yl)pentan-1-amine.
| Compound Name | 1-(4-phenyl-1,2,4-triazol-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 62709915 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 1-(4-phenyl-1,2,4-triazol-3-yl)pentan-1-amine |
| SMILES | CCCCC(N)c1nncn1-c1ccccc1 |
| InChI | InChI=1S/C13H18N4/c1-2-3-9-12(14)13-16-15-10-17(13)11-7-5-4-6-8-11/h4-8,10,12H,2-3,9,14H2,1H3 |
| InChIKey | AEJLXTRFQQFOAK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |