C15H21N3 — CID 82995820
3-heptan-4-yl-4-phenyl-1,2,4-triazole (PubChem CID 82995820) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-heptan-4-yl-4-phenyl-1,2,4-triazole.
| Compound Name | 3-heptan-4-yl-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 82995820 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 3-heptan-4-yl-4-phenyl-1,2,4-triazole |
| SMILES | CCCC(CCC)c1nncn1-c1ccccc1 |
| InChI | InChI=1S/C15H21N3/c1-3-8-13(9-4-2)15-17-16-12-18(15)14-10-6-5-7-11-14/h5-7,10-13H,3-4,8-9H2,1-2H3 |
| InChIKey | OYMIXQIFCOCUOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |