C12H15N3O — CID 107944041
4-phenyl-3-(propoxymethyl)-1,2,4-triazole (PubChem CID 107944041) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-phenyl-3-(propoxymethyl)-1,2,4-triazole.
| Compound Name | 4-phenyl-3-(propoxymethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 107944041 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 4-phenyl-3-(propoxymethyl)-1,2,4-triazole |
| SMILES | CCCOCc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C12H15N3O/c1-2-8-16-9-12-14-13-10-15(12)11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | SAKSMTCERMZZPK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|