C8H8N4 — CID 12949094
4-phenyl-1,2,4-triazol-3-amine (PubChem CID 12949094) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 4-phenyl-1,2,4-triazol-3-amine.
| Compound Name | 4-phenyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 12949094 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4-phenyl-1,2,4-triazol-3-amine |
| SMILES | Nc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C8H8N4/c9-8-11-10-6-12(8)7-4-2-1-3-5-7/h1-6H,(H2,9,11) |
| InChIKey | IDNHWGLZSOOKAT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |