C14H11BrN4 — CID 115297043
4-bromo-3-(4-phenyl-1,2,4-triazol-3-yl)aniline (PubChem CID 115297043) has the molecular formula C14H11BrN4 and a molecular weight of 315.17 g/mol. Its IUPAC name is 4-bromo-3-(4-phenyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-bromo-3-(4-phenyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 115297043 |
| Molecular Formula | C14H11BrN4 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-bromo-3-(4-phenyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Nc1ccc(Br)c(-c2nncn2-c2ccccc2)c1 |
| InChI | InChI=1S/C14H11BrN4/c15-13-7-6-10(16)8-12(13)14-18-17-9-19(14)11-4-2-1-3-5-11/h1-9H,16H2 |
| InChIKey | USZQNRZBYOGFBB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|