C15H14N4O — CID 115412400
4-methoxy-2-(4-phenyl-1,2,4-triazol-3-yl)aniline (PubChem CID 115412400) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-methoxy-2-(4-phenyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 4-methoxy-2-(4-phenyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 115412400 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-methoxy-2-(4-phenyl-1,2,4-triazol-3-yl)aniline |
| SMILES | COc1ccc(N)c(-c2nncn2-c2ccccc2)c1 |
| InChI | InChI=1S/C15H14N4O/c1-20-12-7-8-14(16)13(9-12)15-18-17-10-19(15)11-5-3-2-4-6-11/h2-10H,16H2,1H3 |
| InChIKey | QFSXMEMBSLCPCW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|